C14H21NO5S — CID 71321713
1-ethyl-6,7-dimethoxy-3,4-dihydroisoquinoline;methanesulfonic acid (PubChem CID 71321713) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is 1-ethyl-6,7-dimethoxy-3,4-dihydroisoquinoline;methanesulfonic acid.
| Compound Name | 1-ethyl-6,7-dimethoxy-3,4-dihydroisoquinoline;methanesulfonic acid |
|---|---|
| PubChem CID | 71321713 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-ethyl-6,7-dimethoxy-3,4-dihydroisoquinoline;methanesulfonic acid |
| SMILES | CCC1=NCCc2cc(OC)c(OC)cc21.CS(=O)(=O)O |
| InChI | InChI=1S/C13H17NO2.CH4O3S/c1-4-11-10-8-13(16-3)12(15-2)7-9(10)5-6-14-11;1-5(2,3)4/h7-8H,4-6H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | PJIQJZKYLZYERJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|