C20H22N2O4 — CID 11057351
benzyl N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]carbamate (PubChem CID 11057351) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is benzyl N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]carbamate.
| Compound Name | benzyl N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]carbamate |
|---|---|
| PubChem CID | 11057351 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | benzyl N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]carbamate |
| SMILES | COc1cc2c(cc1OC)C(CNC(=O)OCc1ccccc1)=NCC2 |
| InChI | InChI=1S/C20H22N2O4/c1-24-18-10-15-8-9-21-17(16(15)11-19(18)25-2)12-22-20(23)26-13-14-6-4-3-5-7-14/h3-7,10-11H,8-9,12-13H2,1-2H3,(H,22,23) |
| InChIKey | LGEFLNBIGRJNHG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |