About N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride
N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride (PubChem CID 70505599) has the molecular formula C24H25ClN2O2
and a molecular weight of 408.93 g/mol. Its IUPAC name is N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride.
Molecular Properties
| Compound Name | N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride |
| PubChem CID | 70505599 |
| Molecular Formula | C24H25ClN2O2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(CN(c1ccccc1)c1ccccc1)=NCC2.Cl |
| InChI | InChI=1S/C24H24N2O2.ClH/c1-27-23-15-18-13-14-25-22(21(18)16-24(23)28-2)17-26(19-9-5-3-6-10-19)20-11-7-4-8-12-20;/h3-12,15-16H,13-14,17H2,1-2H3;1H |
| InChIKey | ODKSIQAYLRCGHP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride?
The IUPAC name of N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride (CID 70505599) is N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride.
What is the SMILES notation for N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride?
The canonical SMILES for N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride is COc1cc2c(cc1OC)C(CN(c1ccccc1)c1ccccc1)=NCC2.Cl.
What is the InChIKey of N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride?
The InChIKey is ODKSIQAYLRCGHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2O2.ClH/c1-27-23-15-18-13-14-25-22(21(18)16-24(23)28-2)17-26(19-9-5-3-6-10-19)20-11-7-4-8-12-20;/h3-12,15-16H,13-14,17H2,1-2H3;1H.
What are the key properties of N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride?
N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride has a molecular weight of 408.93 g/mol, XLogP of 5.31, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-N-phenylaniline;hydrochloride is sourced from PubChem (CID 70505599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).