C15H8BrNO4 — CID 155933599
2-(6-bromo-1,3-benzodioxol-5-yl)-3,1-benzoxazin-4-one (PubChem CID 155933599) has the molecular formula C15H8BrNO4 and a molecular weight of 346.14 g/mol. Its IUPAC name is 2-(6-bromo-1,3-benzodioxol-5-yl)-3,1-benzoxazin-4-one.
| Compound Name | 2-(6-bromo-1,3-benzodioxol-5-yl)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 155933599 |
| Molecular Formula | C15H8BrNO4 |
| Molecular Weight | 346.14 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | 2-(6-bromo-1,3-benzodioxol-5-yl)-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(-c2cc3c(cc2Br)OCO3)nc2ccccc12 |
| InChI | InChI=1S/C15H8BrNO4/c16-10-6-13-12(19-7-20-13)5-9(10)14-17-11-4-2-1-3-8(11)15(18)21-14/h1-6H,7H2 |
| InChIKey | BPFGLOVXVBWJHO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.14 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |