C19H16N4O2S — CID 135574714
N-(1,3-benzodioxol-5-ylmethyl)-5-(1H-indol-3-yl)-3,4-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135574714) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-(1H-indol-3-yl)-3,4-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(1H-indol-3-yl)-3,4-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135574714 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(1H-indol-3-yl)-3,4-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | C1=C(c2c[nH]c3ccccc23)NN/C(=N/Cc2ccc3c(c2)OCO3)S1 |
| InChI | InChI=1S/C19H16N4O2S/c1-2-4-15-13(3-1)14(9-20-15)16-10-26-19(23-22-16)21-8-12-5-6-17-18(7-12)25-11-24-17/h1-7,9-10,20,22H,8,11H2,(H,21,23) |
| InChIKey | IGXDKDLKNGIYRO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|