C17H17N2O2+ — CID 8022812
[(2R)-2-(1,3-benzodioxol-5-yl)-2-(1H-indol-3-yl)ethyl]azanium (PubChem CID 8022812) has the molecular formula C17H17N2O2+ and a molecular weight of 281.34 g/mol. Its IUPAC name is [(2R)-2-(1,3-benzodioxol-5-yl)-2-(1H-indol-3-yl)ethyl]azanium.
| Compound Name | [(2R)-2-(1,3-benzodioxol-5-yl)-2-(1H-indol-3-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8022812 |
| Molecular Formula | C17H17N2O2+ |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [(2R)-2-(1,3-benzodioxol-5-yl)-2-(1H-indol-3-yl)ethyl]azanium |
| SMILES | [NH3+]C[C@H](c1ccc2c(c1)OCO2)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H16N2O2/c18-8-13(11-5-6-16-17(7-11)21-10-20-16)14-9-19-15-4-2-1-3-12(14)15/h1-7,9,13,19H,8,10,18H2/p+1/t13-/m1/s1 |
| InChIKey | BDWOJIBKVAHWJJ-CYBMUJFWSA-O |
| XLogP | 2.27 |
| TPSA | 61.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |