C19H19N3O2S — CID 135774938
N-(1,3-benzodioxol-5-ylmethyl)-5-(4-ethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135774938) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-(4-ethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(4-ethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135774938 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(4-ethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | CCc1ccc(C2=NN/C(=N/Cc3ccc4c(c3)OCO4)SC2)cc1 |
| InChI | InChI=1S/C19H19N3O2S/c1-2-13-3-6-15(7-4-13)16-11-25-19(22-21-16)20-10-14-5-8-17-18(9-14)24-12-23-17/h3-9H,2,10-12H2,1H3,(H,20,22) |
| InChIKey | PYAWEVDLBIAYET-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|