C12H22N2OS2 — CID 137003296
N-(2-methyl-2-methylsulfanylpropyl)-8-oxa-3-thia-1-azaspiro[4.5]decan-2-imine (PubChem CID 137003296) has the molecular formula C12H22N2OS2 and a molecular weight of 274.45 g/mol. Its IUPAC name is N-(2-methyl-2-methylsulfanylpropyl)-8-oxa-3-thia-1-azaspiro[4.5]decan-2-imine.
| Compound Name | N-(2-methyl-2-methylsulfanylpropyl)-8-oxa-3-thia-1-azaspiro[4.5]decan-2-imine |
|---|---|
| PubChem CID | 137003296 |
| Molecular Formula | C12H22N2OS2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-(2-methyl-2-methylsulfanylpropyl)-8-oxa-3-thia-1-azaspiro[4.5]decan-2-imine |
| SMILES | CSC(C)(C)C/N=C1/NC2(CCOCC2)CS1 |
| InChI | InChI=1S/C12H22N2OS2/c1-11(2,16-3)8-13-10-14-12(9-17-10)4-6-15-7-5-12/h4-9H2,1-3H3,(H,13,14) |
| InChIKey | WQDQFXUWGVSXPR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|