C10H20N2S2 — CID 137011012
4,4-dimethyl-N-(2-methyl-2-methylsulfanylpropyl)-1,3-thiazolidin-2-imine (PubChem CID 137011012) has the molecular formula C10H20N2S2 and a molecular weight of 232.42 g/mol. Its IUPAC name is 4,4-dimethyl-N-(2-methyl-2-methylsulfanylpropyl)-1,3-thiazolidin-2-imine.
| Compound Name | 4,4-dimethyl-N-(2-methyl-2-methylsulfanylpropyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 137011012 |
| Molecular Formula | C10H20N2S2 |
| Molecular Weight | 232.42 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 4,4-dimethyl-N-(2-methyl-2-methylsulfanylpropyl)-1,3-thiazolidin-2-imine |
| SMILES | CSC(C)(C)C/N=C1/NC(C)(C)CS1 |
| InChI | InChI=1S/C10H20N2S2/c1-9(2)7-14-8(12-9)11-6-10(3,4)13-5/h6-7H2,1-5H3,(H,11,12) |
| InChIKey | NXKVQZVVGNIPRC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|