C12H24N2S2 — CID 136896889
4,4-dimethyl-N-(5-methylsulfanylpentyl)-1,3-thiazinan-2-imine (PubChem CID 136896889) has the molecular formula C12H24N2S2 and a molecular weight of 260.47 g/mol. Its IUPAC name is 4,4-dimethyl-N-(5-methylsulfanylpentyl)-1,3-thiazinan-2-imine.
| Compound Name | 4,4-dimethyl-N-(5-methylsulfanylpentyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136896889 |
| Molecular Formula | C12H24N2S2 |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4,4-dimethyl-N-(5-methylsulfanylpentyl)-1,3-thiazinan-2-imine |
| SMILES | CSCCCCC/N=C1/NC(C)(C)CCS1 |
| InChI | InChI=1S/C12H24N2S2/c1-12(2)7-10-16-11(14-12)13-8-5-4-6-9-15-3/h4-10H2,1-3H3,(H,13,14) |
| InChIKey | IMWRUMHPVJEWPM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|