C12H24N2OS — CID 137000128
4,4-dimethyl-N-[2-(2-methylpropoxy)ethyl]-1,3-thiazinan-2-imine (PubChem CID 137000128) has the molecular formula C12H24N2OS and a molecular weight of 244.40 g/mol. Its IUPAC name is 4,4-dimethyl-N-[2-(2-methylpropoxy)ethyl]-1,3-thiazinan-2-imine.
| Compound Name | 4,4-dimethyl-N-[2-(2-methylpropoxy)ethyl]-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 137000128 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 4,4-dimethyl-N-[2-(2-methylpropoxy)ethyl]-1,3-thiazinan-2-imine |
| SMILES | CC(C)COCC/N=C1/NC(C)(C)CCS1 |
| InChI | InChI=1S/C12H24N2OS/c1-10(2)9-15-7-6-13-11-14-12(3,4)5-8-16-11/h10H,5-9H2,1-4H3,(H,13,14) |
| InChIKey | XWQPDMRKURXTMG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|