C12H22N2O2S2 — CID 135977171
N-[(1,1-dioxothiolan-3-yl)methyl]-4,4-diethyl-1,3-thiazolidin-2-imine (PubChem CID 135977171) has the molecular formula C12H22N2O2S2 and a molecular weight of 290.45 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-4,4-diethyl-1,3-thiazolidin-2-imine.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-4,4-diethyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 135977171 |
| Molecular Formula | C12H22N2O2S2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-4,4-diethyl-1,3-thiazolidin-2-imine |
| SMILES | CCC1(CC)CS/C(=N\CC2CCS(=O)(=O)C2)N1 |
| InChI | InChI=1S/C12H22N2O2S2/c1-3-12(4-2)9-17-11(14-12)13-7-10-5-6-18(15,16)8-10/h10H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | ODTISWNACNGYLQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|