C11H21N3OS — CID 135934636
4,4-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazolidin-2-imine (PubChem CID 135934636) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is 4,4-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazolidin-2-imine.
| Compound Name | 4,4-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 135934636 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4,4-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazolidin-2-imine |
| SMILES | CC1(C)CS/C(=N\CCN2CCOCC2)N1 |
| InChI | InChI=1S/C11H21N3OS/c1-11(2)9-16-10(13-11)12-3-4-14-5-7-15-8-6-14/h3-9H2,1-2H3,(H,12,13) |
| InChIKey | DHYLTTXIXXRTDM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|