C12H12Cl2N2O2S2 — CID 137263270
(3aR,6aR)-N-[(2,6-dichlorophenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-d][1,3]thiazol-2-imine (PubChem CID 137263270) has the molecular formula C12H12Cl2N2O2S2 and a molecular weight of 351.28 g/mol. Its IUPAC name is (3aR,6aR)-N-[(2,6-dichlorophenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-d][1,3]thiazol-2-imine.
| Compound Name | (3aR,6aR)-N-[(2,6-dichlorophenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-d][1,3]thiazol-2-imine |
|---|---|
| PubChem CID | 137263270 |
| Molecular Formula | C12H12Cl2N2O2S2 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | (3aR,6aR)-N-[(2,6-dichlorophenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-d][1,3]thiazol-2-imine |
| SMILES | O=S1(=O)C[C@@H]2S/C(=N\Cc3c(Cl)cccc3Cl)N[C@@H]2C1 |
| InChI | InChI=1S/C12H12Cl2N2O2S2/c13-8-2-1-3-9(14)7(8)4-15-12-16-10-5-20(17,18)6-11(10)19-12/h1-3,10-11H,4-6H2,(H,15,16)/t10-,11+/m1/s1 |
| InChIKey | ABQCJMVZLIUCLR-MNOVXSKESA-N |
| XLogP | 2.35 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|