C14H14Cl2N2O4S2 — CID 7632089
N-[(3aS,6aR)-3-(2,3-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methoxyacetamide (PubChem CID 7632089) has the molecular formula C14H14Cl2N2O4S2 and a molecular weight of 409.32 g/mol. Its IUPAC name is N-[(3aS,6aR)-3-(2,3-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methoxyacetamide.
| Compound Name | N-[(3aS,6aR)-3-(2,3-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methoxyacetamide |
|---|---|
| PubChem CID | 7632089 |
| Molecular Formula | C14H14Cl2N2O4S2 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | N-[(3aS,6aR)-3-(2,3-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methoxyacetamide |
| SMILES | COCC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H14Cl2N2O4S2/c1-22-5-12(19)17-14-18(9-4-2-3-8(15)13(9)16)10-6-24(20,21)7-11(10)23-14/h2-4,10-11H,5-7H2,1H3/b17-14-/t10-,11-/m0/s1 |
| InChIKey | MLIRYUCBHVFGJI-WCFDQUBMSA-N |
| XLogP | 2.24 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|