C19H15Cl3N2O3S2 — CID 39879590
N-[(3aR,6aR)-3-(2,3-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-chlorophenyl)acetamide (PubChem CID 39879590) has the molecular formula C19H15Cl3N2O3S2 and a molecular weight of 489.83 g/mol. Its IUPAC name is N-[(3aR,6aR)-3-(2,3-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-chlorophenyl)acetamide.
| Compound Name | N-[(3aR,6aR)-3-(2,3-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 39879590 |
| Molecular Formula | C19H15Cl3N2O3S2 |
| Molecular Weight | 489.83 g/mol |
| Exact Mass | 487.96 |
| IUPAC Name | N-[(3aR,6aR)-3-(2,3-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(2-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1Cl)/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H15Cl3N2O3S2/c20-12-5-2-1-4-11(12)8-17(25)23-19-24(14-7-3-6-13(21)18(14)22)15-9-29(26,27)10-16(15)28-19/h1-7,15-16H,8-10H2/b23-19-/t15-,16+/m1/s1 |
| InChIKey | GXTFUULHVLVVRF-UMSQGIPESA-N |
| XLogP | 4.49 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.83 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|