C18H15ClF2N2O2S2 — CID 2144834
(3aR,6aR)-N-[(2-chloro-6-fluorophenyl)methyl]-N-(2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine (PubChem CID 2144834) has the molecular formula C18H15ClF2N2O2S2 and a molecular weight of 428.91 g/mol. Its IUPAC name is (3aR,6aR)-N-[(2-chloro-6-fluorophenyl)methyl]-N-(2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine.
| Compound Name | (3aR,6aR)-N-[(2-chloro-6-fluorophenyl)methyl]-N-(2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 2144834 |
| Molecular Formula | C18H15ClF2N2O2S2 |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | (3aR,6aR)-N-[(2-chloro-6-fluorophenyl)methyl]-N-(2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
| SMILES | O=S1(=O)C[C@@H]2SC(N(Cc3c(F)cccc3Cl)c3ccccc3F)=N[C@@H]2C1 |
| InChI | InChI=1S/C18H15ClF2N2O2S2/c19-12-4-3-6-13(20)11(12)8-23(16-7-2-1-5-14(16)21)18-22-15-9-27(24,25)10-17(15)26-18/h1-7,15,17H,8-10H2/t15-,17+/m1/s1 |
| InChIKey | DEVCPJJPBHURQL-WBVHZDCISA-N |
| XLogP | 3.89 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |