C19H17F2N3O3S2 — CID 92701743
2-(N-[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-fluoroanilino)-N-(4-fluorophenyl)acetamide (PubChem CID 92701743) has the molecular formula C19H17F2N3O3S2 and a molecular weight of 437.49 g/mol. Its IUPAC name is 2-(N-[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-fluoroanilino)-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-(N-[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-fluoroanilino)-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 92701743 |
| Molecular Formula | C19H17F2N3O3S2 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 2-(N-[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-fluoroanilino)-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CN(C1=N[C@H]2CS(=O)(=O)C[C@@H]2S1)c1ccc(F)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H17F2N3O3S2/c20-12-1-5-14(6-2-12)22-18(25)9-24(15-7-3-13(21)4-8-15)19-23-16-10-29(26,27)11-17(16)28-19/h1-8,16-17H,9-11H2,(H,22,25)/t16-,17-/m0/s1 |
| InChIKey | SMYQJLGKIXVIQQ-IRXDYDNUSA-N |
| XLogP | 2.68 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |