C20H17F4N3O3S2 — CID 92669299
2-(N-[(3aR,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-fluoroanilino)-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 92669299) has the molecular formula C20H17F4N3O3S2 and a molecular weight of 487.50 g/mol. Its IUPAC name is 2-(N-[(3aR,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-fluoroanilino)-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(N-[(3aR,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-fluoroanilino)-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 92669299 |
| Molecular Formula | C20H17F4N3O3S2 |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 2-(N-[(3aR,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-fluoroanilino)-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN(C1=N[C@@H]2CS(=O)(=O)C[C@@H]2S1)c1ccc(F)cc1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H17F4N3O3S2/c21-12-5-7-13(8-6-12)27(19-26-16-10-32(29,30)11-17(16)31-19)9-18(28)25-15-4-2-1-3-14(15)20(22,23)24/h1-8,16-17H,9-11H2,(H,25,28)/t16-,17+/m1/s1 |
| InChIKey | YVYHEOVKQSEAAC-SJORKVTESA-N |
| XLogP | 3.56 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |