C22H22F3N3O3S2 — CID 92669327
2-(N-[(3aR,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-3,4-dimethylanilino)-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 92669327) has the molecular formula C22H22F3N3O3S2 and a molecular weight of 497.56 g/mol. Its IUPAC name is 2-(N-[(3aR,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-3,4-dimethylanilino)-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(N-[(3aR,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-3,4-dimethylanilino)-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 92669327 |
| Molecular Formula | C22H22F3N3O3S2 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 2-(N-[(3aR,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-3,4-dimethylanilino)-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(N(CC(=O)Nc2ccccc2C(F)(F)F)C2=N[C@@H]3CS(=O)(=O)C[C@@H]3S2)cc1C |
| InChI | InChI=1S/C22H22F3N3O3S2/c1-13-7-8-15(9-14(13)2)28(21-27-18-11-33(30,31)12-19(18)32-21)10-20(29)26-17-6-4-3-5-16(17)22(23,24)25/h3-9,18-19H,10-12H2,1-2H3,(H,26,29)/t18-,19+/m1/s1 |
| InChIKey | PEGADRXPRROTHS-MOPGFXCFSA-N |
| XLogP | 4.04 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |