C22H24ClN3O4S2 — CID 18559492
N-(5-chloro-2-methoxyphenyl)-2-(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-3,4-dimethylanilino)acetamide (PubChem CID 18559492) has the molecular formula C22H24ClN3O4S2 and a molecular weight of 494.04 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-3,4-dimethylanilino)acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-3,4-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 18559492 |
| Molecular Formula | C22H24ClN3O4S2 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-3,4-dimethylanilino)acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN(C1=NC2CS(=O)(=O)CC2S1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C22H24ClN3O4S2/c1-13-4-6-16(8-14(13)2)26(22-25-18-11-32(28,29)12-20(18)31-22)10-21(27)24-17-9-15(23)5-7-19(17)30-3/h4-9,18,20H,10-12H2,1-3H3,(H,24,27) |
| InChIKey | DJOWLVPSKAFTKB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |