C21H22FN3O3S2 — CID 2141016
2-(N-[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-ethylanilino)-N-(4-fluorophenyl)acetamide (PubChem CID 2141016) has the molecular formula C21H22FN3O3S2 and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-(N-[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-ethylanilino)-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-(N-[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-ethylanilino)-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 2141016 |
| Molecular Formula | C21H22FN3O3S2 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 2-(N-[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-4-ethylanilino)-N-(4-fluorophenyl)acetamide |
| SMILES | CCc1ccc(N(CC(=O)Nc2ccc(F)cc2)C2=N[C@@H]3CS(=O)(=O)C[C@H]3S2)cc1 |
| InChI | InChI=1S/C21H22FN3O3S2/c1-2-14-3-9-17(10-4-14)25(11-20(26)23-16-7-5-15(22)6-8-16)21-24-18-12-30(27,28)13-19(18)29-21/h3-10,18-19H,2,11-13H2,1H3,(H,23,26)/t18-,19-/m1/s1 |
| InChIKey | FOYIEQAGTPWORV-RTBURBONSA-N |
| XLogP | 3.10 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |