C22H24FN3O3S2 — CID 23603694
2-(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-4-fluoroanilino)-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 23603694) has the molecular formula C22H24FN3O3S2 and a molecular weight of 461.58 g/mol. Its IUPAC name is 2-(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-4-fluoroanilino)-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-4-fluoroanilino)-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 23603694 |
| Molecular Formula | C22H24FN3O3S2 |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 2-(N-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)-4-fluoroanilino)-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CN(C2=NC3CS(=O)(=O)CC3S2)c2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C22H24FN3O3S2/c1-13-8-14(2)21(15(3)9-13)25-20(27)10-26(17-6-4-16(23)5-7-17)22-24-18-11-31(28,29)12-19(18)30-22/h4-9,18-19H,10-12H2,1-3H3,(H,25,27) |
| InChIKey | UCFWIPMDAIDGMJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |