C23H28N2O2S2 — CID 92716769
(3aS,6aR)-N-[(2,5-dimethylphenyl)methyl]-5,5-dioxo-N-(4-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine (PubChem CID 92716769) has the molecular formula C23H28N2O2S2 and a molecular weight of 428.62 g/mol. Its IUPAC name is (3aS,6aR)-N-[(2,5-dimethylphenyl)methyl]-5,5-dioxo-N-(4-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine.
| Compound Name | (3aS,6aR)-N-[(2,5-dimethylphenyl)methyl]-5,5-dioxo-N-(4-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 92716769 |
| Molecular Formula | C23H28N2O2S2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (3aS,6aR)-N-[(2,5-dimethylphenyl)methyl]-5,5-dioxo-N-(4-propan-2-ylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
| SMILES | Cc1ccc(C)c(CN(C2=N[C@H]3CS(=O)(=O)C[C@@H]3S2)c2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C23H28N2O2S2/c1-15(2)18-7-9-20(10-8-18)25(12-19-11-16(3)5-6-17(19)4)23-24-21-13-29(26,27)14-22(21)28-23/h5-11,15,21-22H,12-14H2,1-4H3/t21-,22-/m0/s1 |
| InChIKey | KEKWFCVCPLMPAE-VXKWHMMOSA-N |
| XLogP | 4.70 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |