C19H18ClFN2O2S2 — CID 23603716
N-[(2-chloro-6-fluorophenyl)methyl]-N-(3-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine (PubChem CID 23603716) has the molecular formula C19H18ClFN2O2S2 and a molecular weight of 424.95 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-(3-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-(3-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 23603716 |
| Molecular Formula | C19H18ClFN2O2S2 |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-(3-methylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
| SMILES | Cc1cccc(N(Cc2c(F)cccc2Cl)C2=NC3CS(=O)(=O)CC3S2)c1 |
| InChI | InChI=1S/C19H18ClFN2O2S2/c1-12-4-2-5-13(8-12)23(9-14-15(20)6-3-7-16(14)21)19-22-17-10-27(24,25)11-18(17)26-19/h2-8,17-18H,9-11H2,1H3 |
| InChIKey | INQLYJHHYBPTJE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |