C21H24N2O3S2 — CID 2138491
(3aR,6aR)-N-[(2,5-dimethylphenyl)methyl]-N-(3-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine (PubChem CID 2138491) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is (3aR,6aR)-N-[(2,5-dimethylphenyl)methyl]-N-(3-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine.
| Compound Name | (3aR,6aR)-N-[(2,5-dimethylphenyl)methyl]-N-(3-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 2138491 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (3aR,6aR)-N-[(2,5-dimethylphenyl)methyl]-N-(3-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-amine |
| SMILES | COc1cccc(N(Cc2cc(C)ccc2C)C2=N[C@@H]3CS(=O)(=O)C[C@@H]3S2)c1 |
| InChI | InChI=1S/C21H24N2O3S2/c1-14-7-8-15(2)16(9-14)11-23(17-5-4-6-18(10-17)26-3)21-22-19-12-28(24,25)13-20(19)27-21/h4-10,19-20H,11-13H2,1-3H3/t19-,20+/m1/s1 |
| InChIKey | KVXIGLPKYOBABF-UXHICEINSA-N |
| XLogP | 3.59 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |