C22H24ClN3O3S2 — CID 20875083
4-[(2-chlorophenyl)methyl-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-propan-2-ylbenzamide (PubChem CID 20875083) has the molecular formula C22H24ClN3O3S2 and a molecular weight of 478.04 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-propan-2-ylbenzamide.
| Compound Name | 4-[(2-chlorophenyl)methyl-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 20875083 |
| Molecular Formula | C22H24ClN3O3S2 |
| Molecular Weight | 478.04 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl-(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(N(Cc2ccccc2Cl)C2=NC3CS(=O)(=O)CC3S2)cc1 |
| InChI | InChI=1S/C22H24ClN3O3S2/c1-14(2)24-21(27)15-7-9-17(10-8-15)26(11-16-5-3-4-6-18(16)23)22-25-19-12-31(28,29)13-20(19)30-22/h3-10,14,19-20H,11-13H2,1-2H3,(H,24,27) |
| InChIKey | NLJGYSSCHGPMGP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.04 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |