C18H24N2O4S2 — CID 92716817
ethyl 4-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-butylamino]benzoate (PubChem CID 92716817) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is ethyl 4-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-butylamino]benzoate.
| Compound Name | ethyl 4-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-butylamino]benzoate |
|---|---|
| PubChem CID | 92716817 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | ethyl 4-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]-butylamino]benzoate |
| SMILES | CCCCN(C1=N[C@H]2CS(=O)(=O)C[C@@H]2S1)c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C18H24N2O4S2/c1-3-5-10-20(14-8-6-13(7-9-14)17(21)24-4-2)18-19-15-11-26(22,23)12-16(15)25-18/h6-9,15-16H,3-5,10-12H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | UVYDMKJOTYRMDL-HOTGVXAUSA-N |
| XLogP | 2.74 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |