C18H25N3O3S2 — CID 20875034
N-butyl-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-N-methylacetamide (PubChem CID 20875034) has the molecular formula C18H25N3O3S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-butyl-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-N-methylacetamide.
| Compound Name | N-butyl-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 20875034 |
| Molecular Formula | C18H25N3O3S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-butyl-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-N-methylacetamide |
| SMILES | CCCCN(C)C(=O)Cc1ccc(NC2=NC3CS(=O)(=O)CC3S2)cc1 |
| InChI | InChI=1S/C18H25N3O3S2/c1-3-4-9-21(2)17(22)10-13-5-7-14(8-6-13)19-18-20-15-11-26(23,24)12-16(15)25-18/h5-8,15-16H,3-4,9-12H2,1-2H3,(H,19,20) |
| InChIKey | GOHNYZIFJMOFMY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |