C17H23N3O3S2 — CID 53337879
N-butan-2-yl-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]acetamide (PubChem CID 53337879) has the molecular formula C17H23N3O3S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is N-butan-2-yl-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]acetamide.
| Compound Name | N-butan-2-yl-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 53337879 |
| Molecular Formula | C17H23N3O3S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-butan-2-yl-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]acetamide |
| SMILES | CCC(C)NC(=O)Cc1ccc(NC2=NC3CS(=O)(=O)CC3S2)cc1 |
| InChI | InChI=1S/C17H23N3O3S2/c1-3-11(2)18-16(21)8-12-4-6-13(7-5-12)19-17-20-14-9-25(22,23)10-15(14)24-17/h4-7,11,14-15H,3,8-10H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | KINAEKHCDDHOSL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |