C23H30N4O4S2 — CID 98476606
2-[4-[[(3aS,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]phenyl]-N-[2-[furan-2-ylmethyl(propan-2-yl)amino]ethyl]acetamide (PubChem CID 98476606) has the molecular formula C23H30N4O4S2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 2-[4-[[(3aS,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]phenyl]-N-[2-[furan-2-ylmethyl(propan-2-yl)amino]ethyl]acetamide.
| Compound Name | 2-[4-[[(3aS,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]phenyl]-N-[2-[furan-2-ylmethyl(propan-2-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 98476606 |
| Molecular Formula | C23H30N4O4S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 2-[4-[[(3aS,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]phenyl]-N-[2-[furan-2-ylmethyl(propan-2-yl)amino]ethyl]acetamide |
| SMILES | CC(C)N(CCNC(=O)Cc1ccc(NC2=N[C@H]3CS(=O)(=O)C[C@H]3S2)cc1)Cc1ccco1 |
| InChI | InChI=1S/C23H30N4O4S2/c1-16(2)27(13-19-4-3-11-31-19)10-9-24-22(28)12-17-5-7-18(8-6-17)25-23-26-20-14-33(29,30)15-21(20)32-23/h3-8,11,16,20-21H,9-10,12-15H2,1-2H3,(H,24,28)(H,25,26)/t20-,21+/m0/s1 |
| InChIKey | JOZMPOMLHIMARO-LEWJYISDSA-N |
| XLogP | 2.53 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |