C15H20N4O3 — CID 166372648
N-[2-[furan-2-ylmethyl(propan-2-yl)amino]ethyl]-6-oxo-1H-pyridazine-5-carboxamide (PubChem CID 166372648) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[2-[furan-2-ylmethyl(propan-2-yl)amino]ethyl]-6-oxo-1H-pyridazine-5-carboxamide.
| Compound Name | N-[2-[furan-2-ylmethyl(propan-2-yl)amino]ethyl]-6-oxo-1H-pyridazine-5-carboxamide |
|---|---|
| PubChem CID | 166372648 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-[2-[furan-2-ylmethyl(propan-2-yl)amino]ethyl]-6-oxo-1H-pyridazine-5-carboxamide |
| SMILES | CC(C)N(CCNC(=O)c1ccn[nH]c1=O)Cc1ccco1 |
| InChI | InChI=1S/C15H20N4O3/c1-11(2)19(10-12-4-3-9-22-12)8-7-16-14(20)13-5-6-17-18-15(13)21/h3-6,9,11H,7-8,10H2,1-2H3,(H,16,20)(H,18,21) |
| InChIKey | XJFTVHOHGWMEKN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |