C23H28N4O3S2 — CID 124772418
3-[[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-N-[3-(N-ethylanilino)propyl]benzamide (PubChem CID 124772418) has the molecular formula C23H28N4O3S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is 3-[[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-N-[3-(N-ethylanilino)propyl]benzamide.
| Compound Name | 3-[[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-N-[3-(N-ethylanilino)propyl]benzamide |
|---|---|
| PubChem CID | 124772418 |
| Molecular Formula | C23H28N4O3S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 3-[[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-N-[3-(N-ethylanilino)propyl]benzamide |
| SMILES | CCN(CCCNC(=O)c1cccc(NC2=N[C@@H]3CS(=O)(=O)C[C@H]3S2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H28N4O3S2/c1-2-27(19-10-4-3-5-11-19)13-7-12-24-22(28)17-8-6-9-18(14-17)25-23-26-20-15-32(29,30)16-21(20)31-23/h3-6,8-11,14,20-21H,2,7,12-13,15-16H2,1H3,(H,24,28)(H,25,26)/t20-,21-/m1/s1 |
| InChIKey | ZFJJXPHGVPMSQK-NHCUHLMSSA-N |
| XLogP | 3.01 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|