C19H21N3O3S3 — CID 92693730
3-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-N-[2-(3-methylthiophen-2-yl)ethyl]benzamide (PubChem CID 92693730) has the molecular formula C19H21N3O3S3 and a molecular weight of 435.60 g/mol. Its IUPAC name is 3-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-N-[2-(3-methylthiophen-2-yl)ethyl]benzamide.
| Compound Name | 3-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-N-[2-(3-methylthiophen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 92693730 |
| Molecular Formula | C19H21N3O3S3 |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 3-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-N-[2-(3-methylthiophen-2-yl)ethyl]benzamide |
| SMILES | Cc1ccsc1CCNC(=O)c1cccc(NC2=N[C@H]3CS(=O)(=O)C[C@@H]3S2)c1 |
| InChI | InChI=1S/C19H21N3O3S3/c1-12-6-8-26-16(12)5-7-20-18(23)13-3-2-4-14(9-13)21-19-22-15-10-28(24,25)11-17(15)27-19/h2-4,6,8-9,15,17H,5,7,10-11H2,1H3,(H,20,23)(H,21,22)/t15-,17-/m0/s1 |
| InChIKey | AHWRBWOEKAOSDC-RDJZCZTQSA-N |
| XLogP | 2.71 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |