C16H19N3O3S2 — CID 46258588
N-cyclopropyl-3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-4-methylbenzamide (PubChem CID 46258588) has the molecular formula C16H19N3O3S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-cyclopropyl-3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-4-methylbenzamide.
| Compound Name | N-cyclopropyl-3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-4-methylbenzamide |
|---|---|
| PubChem CID | 46258588 |
| Molecular Formula | C16H19N3O3S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-cyclopropyl-3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1NC1=NC2CS(=O)(=O)CC2S1 |
| InChI | InChI=1S/C16H19N3O3S2/c1-9-2-3-10(15(20)17-11-4-5-11)6-12(9)18-16-19-13-7-24(21,22)8-14(13)23-16/h2-3,6,11,13-14H,4-5,7-8H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | UCDVBXVHPCBRHM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |