C23H27N3O3S2 — CID 20875061
3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-4-methyl-N-(4-phenylbutan-2-yl)benzamide (PubChem CID 20875061) has the molecular formula C23H27N3O3S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-4-methyl-N-(4-phenylbutan-2-yl)benzamide.
| Compound Name | 3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-4-methyl-N-(4-phenylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 20875061 |
| Molecular Formula | C23H27N3O3S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-4-methyl-N-(4-phenylbutan-2-yl)benzamide |
| SMILES | Cc1ccc(C(=O)NC(C)CCc2ccccc2)cc1NC1=NC2CS(=O)(=O)CC2S1 |
| InChI | InChI=1S/C23H27N3O3S2/c1-15-8-11-18(22(27)24-16(2)9-10-17-6-4-3-5-7-17)12-19(15)25-23-26-20-13-31(28,29)14-21(20)30-23/h3-8,11-12,16,20-21H,9-10,13-14H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | JEBFDLNPIHOASR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |