C20H20ClN3O3S2 — CID 53337891
4-chloro-3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-(2-phenylethyl)benzamide (PubChem CID 53337891) has the molecular formula C20H20ClN3O3S2 and a molecular weight of 449.99 g/mol. Its IUPAC name is 4-chloro-3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-(2-phenylethyl)benzamide.
| Compound Name | 4-chloro-3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 53337891 |
| Molecular Formula | C20H20ClN3O3S2 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 4-chloro-3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-(2-phenylethyl)benzamide |
| SMILES | O=C(NCCc1ccccc1)c1ccc(Cl)c(NC2=NC3CS(=O)(=O)CC3S2)c1 |
| InChI | InChI=1S/C20H20ClN3O3S2/c21-15-7-6-14(19(25)22-9-8-13-4-2-1-3-5-13)10-16(15)23-20-24-17-11-29(26,27)12-18(17)28-20/h1-7,10,17-18H,8-9,11-12H2,(H,22,25)(H,23,24) |
| InChIKey | YRJIDCOGLMPSQF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |