C16H18ClN3O3S2 — CID 4180498
[4-chloro-3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 4180498) has the molecular formula C16H18ClN3O3S2 and a molecular weight of 399.93 g/mol. Its IUPAC name is [4-chloro-3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-chloro-3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 4180498 |
| Molecular Formula | C16H18ClN3O3S2 |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | [4-chloro-3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc(Cl)c(NC2=NC3CS(=O)(=O)CC3S2)c1)N1CCCC1 |
| InChI | InChI=1S/C16H18ClN3O3S2/c17-11-4-3-10(15(21)20-5-1-2-6-20)7-12(11)18-16-19-13-8-25(22,23)9-14(13)24-16/h3-4,7,13-14H,1-2,5-6,8-9H2,(H,18,19) |
| InChIKey | LAHNPRDBTPWWEQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |