C23H25ClN4O3S2 — CID 3612823
[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]methanone (PubChem CID 3612823) has the molecular formula C23H25ClN4O3S2 and a molecular weight of 505.07 g/mol. Its IUPAC name is [4-(5-chloro-2-methylphenyl)piperazin-1-yl]-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]methanone.
| Compound Name | [4-(5-chloro-2-methylphenyl)piperazin-1-yl]-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]methanone |
|---|---|
| PubChem CID | 3612823 |
| Molecular Formula | C23H25ClN4O3S2 |
| Molecular Weight | 505.07 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | [4-(5-chloro-2-methylphenyl)piperazin-1-yl]-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]methanone |
| SMILES | Cc1ccc(Cl)cc1N1CCN(C(=O)c2ccc(NC3=NC4CS(=O)(=O)CC4S3)cc2)CC1 |
| InChI | InChI=1S/C23H25ClN4O3S2/c1-15-2-5-17(24)12-20(15)27-8-10-28(11-9-27)22(29)16-3-6-18(7-4-16)25-23-26-19-13-33(30,31)14-21(19)32-23/h2-7,12,19,21H,8-11,13-14H2,1H3,(H,25,26) |
| InChIKey | IITQXXZVXDRKFP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.07 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |