C19H24N4O5S2 — CID 6591890
ethyl 4-[4-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]benzoyl]piperazine-1-carboxylate (PubChem CID 6591890) has the molecular formula C19H24N4O5S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is ethyl 4-[4-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 6591890 |
| Molecular Formula | C19H24N4O5S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | ethyl 4-[4-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(NC3=N[C@H]4CS(=O)(=O)C[C@@H]4S3)cc2)CC1 |
| InChI | InChI=1S/C19H24N4O5S2/c1-2-28-19(25)23-9-7-22(8-10-23)17(24)13-3-5-14(6-4-13)20-18-21-15-11-30(26,27)12-16(15)29-18/h3-6,15-16H,2,7-12H2,1H3,(H,20,21)/t15-,16-/m0/s1 |
| InChIKey | YGRPAVOOXYBWFD-HOTGVXAUSA-N |
| XLogP | 1.28 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |