C20H25N3O5S2 — CID 92693688
ethyl 1-[4-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]benzoyl]piperidine-4-carboxylate (PubChem CID 92693688) has the molecular formula C20H25N3O5S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is ethyl 1-[4-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]benzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 92693688 |
| Molecular Formula | C20H25N3O5S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | ethyl 1-[4-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]benzoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc(NC3=N[C@H]4CS(=O)(=O)C[C@@H]4S3)cc2)CC1 |
| InChI | InChI=1S/C20H25N3O5S2/c1-2-28-19(25)14-7-9-23(10-8-14)18(24)13-3-5-15(6-4-13)21-20-22-16-11-30(26,27)12-17(16)29-20/h3-6,14,16-17H,2,7-12H2,1H3,(H,21,22)/t16-,17-/m0/s1 |
| InChIKey | KWQNYGVIVYDOCL-IRXDYDNUSA-N |
| XLogP | 1.78 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |