C17H21N3O3S2 — CID 20875070
[3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-4-methylphenyl]-pyrrolidin-1-ylmethanone (PubChem CID 20875070) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is [3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-4-methylphenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-4-methylphenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 20875070 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-4-methylphenyl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1ccc(C(=O)N2CCCC2)cc1NC1=NC2CS(=O)(=O)CC2S1 |
| InChI | InChI=1S/C17H21N3O3S2/c1-11-4-5-12(16(21)20-6-2-3-7-20)8-13(11)18-17-19-14-9-25(22,23)10-15(14)24-17/h4-5,8,14-15H,2-3,6-7,9-10H2,1H3,(H,18,19) |
| InChIKey | NREDRJCTZRMQPP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |