C19H25N3O3S2 — CID 18559439
1-(azepan-1-yl)-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]ethanone (PubChem CID 18559439) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 18559439 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-(azepan-1-yl)-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]ethanone |
| SMILES | O=C(Cc1ccc(NC2=NC3CS(=O)(=O)CC3S2)cc1)N1CCCCCC1 |
| InChI | InChI=1S/C19H25N3O3S2/c23-18(22-9-3-1-2-4-10-22)11-14-5-7-15(8-6-14)20-19-21-16-12-27(24,25)13-17(16)26-19/h5-8,16-17H,1-4,9-13H2,(H,20,21) |
| InChIKey | MJXJXOVVTALJLC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |