C20H22N6O3S2 — CID 20874977
[3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 20874977) has the molecular formula C20H22N6O3S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is [3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 20874977 |
| Molecular Formula | C20H22N6O3S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cccc(NC2=NC3CS(=O)(=O)CC3S2)c1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H22N6O3S2/c27-18(25-7-9-26(10-8-25)19-21-5-2-6-22-19)14-3-1-4-15(11-14)23-20-24-16-12-31(28,29)13-17(16)30-20/h1-6,11,16-17H,7-10,12-13H2,(H,23,24) |
| InChIKey | IAOMDCLODOGQPW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |