C24H21N3O4S2 — CID 46258572
3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-(4-phenoxyphenyl)benzamide (PubChem CID 46258572) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-(4-phenoxyphenyl)benzamide.
| Compound Name | 3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-(4-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 46258572 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 3-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-(4-phenoxyphenyl)benzamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)c1cccc(NC2=NC3CS(=O)(=O)CC3S2)c1 |
| InChI | InChI=1S/C24H21N3O4S2/c28-23(25-17-9-11-20(12-10-17)31-19-7-2-1-3-8-19)16-5-4-6-18(13-16)26-24-27-21-14-33(29,30)15-22(21)32-24/h1-13,21-22H,14-15H2,(H,25,28)(H,26,27) |
| InChIKey | LVXJEWQKVGHEAW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |