C18H17N3O3S2 — CID 6621295
4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-phenylbenzamide (PubChem CID 6621295) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-phenylbenzamide.
| Compound Name | 4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 6621295 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(NC2=NC3CS(=O)(=O)CC3S2)cc1 |
| InChI | InChI=1S/C18H17N3O3S2/c22-17(19-13-4-2-1-3-5-13)12-6-8-14(9-7-12)20-18-21-15-10-26(23,24)11-16(15)25-18/h1-9,15-16H,10-11H2,(H,19,22)(H,20,21) |
| InChIKey | ZHGRFZYGIFPYPE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |