C24H29N3O5S2 — CID 4185070
N-[2-(3,4-diethoxyphenyl)ethyl]-4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]benzamide (PubChem CID 4185070) has the molecular formula C24H29N3O5S2 and a molecular weight of 503.65 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]benzamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 4185070 |
| Molecular Formula | C24H29N3O5S2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]benzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2ccc(NC3=NC4CS(=O)(=O)CC4S3)cc2)cc1OCC |
| InChI | InChI=1S/C24H29N3O5S2/c1-3-31-20-10-5-16(13-21(20)32-4-2)11-12-25-23(28)17-6-8-18(9-7-17)26-24-27-19-14-34(29,30)15-22(19)33-24/h5-10,13,19,22H,3-4,11-12,14-15H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | VPHRVYADHLHMOF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |