C24H36N4O3S2 — CID 129426961
4-[[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-N-[3-[cyclohexyl(propan-2-yl)amino]propyl]benzamide (PubChem CID 129426961) has the molecular formula C24H36N4O3S2 and a molecular weight of 492.71 g/mol. Its IUPAC name is 4-[[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-N-[3-[cyclohexyl(propan-2-yl)amino]propyl]benzamide.
| Compound Name | 4-[[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-N-[3-[cyclohexyl(propan-2-yl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 129426961 |
| Molecular Formula | C24H36N4O3S2 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 4-[[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-N-[3-[cyclohexyl(propan-2-yl)amino]propyl]benzamide |
| SMILES | CC(C)N(CCCNC(=O)c1ccc(NC2=N[C@@H]3CS(=O)(=O)C[C@H]3S2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C24H36N4O3S2/c1-17(2)28(20-7-4-3-5-8-20)14-6-13-25-23(29)18-9-11-19(12-10-18)26-24-27-21-15-33(30,31)16-22(21)32-24/h9-12,17,20-22H,3-8,13-16H2,1-2H3,(H,25,29)(H,26,27)/t21-,22-/m1/s1 |
| InChIKey | NDOBEIZYIGFNAP-FGZHOGPDSA-N |
| XLogP | 3.53 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|