C21H29N3O3S2 — CID 20875023
N-cyclooctyl-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]acetamide (PubChem CID 20875023) has the molecular formula C21H29N3O3S2 and a molecular weight of 435.62 g/mol. Its IUPAC name is N-cyclooctyl-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]acetamide.
| Compound Name | N-cyclooctyl-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 20875023 |
| Molecular Formula | C21H29N3O3S2 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-cyclooctyl-2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]acetamide |
| SMILES | O=C(Cc1ccc(NC2=NC3CS(=O)(=O)CC3S2)cc1)NC1CCCCCCC1 |
| InChI | InChI=1S/C21H29N3O3S2/c25-20(22-16-6-4-2-1-3-5-7-16)12-15-8-10-17(11-9-15)23-21-24-18-13-29(26,27)14-19(18)28-21/h8-11,16,18-19H,1-7,12-14H2,(H,22,25)(H,23,24) |
| InChIKey | FFWIJBUAHSVLPK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |