C19H20N4O3S2 — CID 20874986
2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 20874986) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 20874986 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(Cc1ccc(NC2=NC3CS(=O)(=O)CC3S2)cc1)NCc1ccccn1 |
| InChI | InChI=1S/C19H20N4O3S2/c24-18(21-10-15-3-1-2-8-20-15)9-13-4-6-14(7-5-13)22-19-23-16-11-28(25,26)12-17(16)27-19/h1-8,16-17H,9-12H2,(H,21,24)(H,22,23) |
| InChIKey | KZJGGQXPDKLNNI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |